C13H8FN5S — CID 103886710
2-fluoro-3-(7H-purin-6-ylsulfanylmethyl)benzonitrile (PubChem CID 103886710) has the molecular formula C13H8FN5S and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-fluoro-3-(7H-purin-6-ylsulfanylmethyl)benzonitrile.
| Compound Name | 2-fluoro-3-(7H-purin-6-ylsulfanylmethyl)benzonitrile |
|---|---|
| PubChem CID | 103886710 |
| Molecular Formula | C13H8FN5S |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-fluoro-3-(7H-purin-6-ylsulfanylmethyl)benzonitrile |
| SMILES | N#Cc1cccc(CSc2ncnc3nc[nH]c23)c1F |
| InChI | InChI=1S/C13H8FN5S/c14-10-8(4-15)2-1-3-9(10)5-20-13-11-12(17-6-16-11)18-7-19-13/h1-3,6-7H,5H2,(H,16,17,18,19) |
| InChIKey | ZGETVMJYAVAHTG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |