C12H10N6O2S — CID 107352701
2-nitro-6-(7H-purin-6-ylsulfanylmethyl)aniline (PubChem CID 107352701) has the molecular formula C12H10N6O2S and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-nitro-6-(7H-purin-6-ylsulfanylmethyl)aniline.
| Compound Name | 2-nitro-6-(7H-purin-6-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 107352701 |
| Molecular Formula | C12H10N6O2S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-nitro-6-(7H-purin-6-ylsulfanylmethyl)aniline |
| SMILES | Nc1c(CSc2ncnc3nc[nH]c23)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N6O2S/c13-9-7(2-1-3-8(9)18(19)20)4-21-12-10-11(15-5-14-10)16-6-17-12/h1-3,5-6H,4,13H2,(H,14,15,16,17) |
| InChIKey | WZYKKVAXOIQRAJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|