C12H10ClN5S — CID 79582600
4-chloro-2-(7H-purin-6-ylsulfanylmethyl)aniline (PubChem CID 79582600) has the molecular formula C12H10ClN5S and a molecular weight of 291.77 g/mol. Its IUPAC name is 4-chloro-2-(7H-purin-6-ylsulfanylmethyl)aniline.
| Compound Name | 4-chloro-2-(7H-purin-6-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 79582600 |
| Molecular Formula | C12H10ClN5S |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 4-chloro-2-(7H-purin-6-ylsulfanylmethyl)aniline |
| SMILES | Nc1ccc(Cl)cc1CSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H10ClN5S/c13-8-1-2-9(14)7(3-8)4-19-12-10-11(16-5-15-10)17-6-18-12/h1-3,5-6H,4,14H2,(H,15,16,17,18) |
| InChIKey | MXGGIEAFSPZQOL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|