C12H8ClN5O2S — CID 62253596
6-[(4-chloro-3-nitrophenyl)methylsulfanyl]-7H-purine (PubChem CID 62253596) has the molecular formula C12H8ClN5O2S and a molecular weight of 321.75 g/mol. Its IUPAC name is 6-[(4-chloro-3-nitrophenyl)methylsulfanyl]-7H-purine.
| Compound Name | 6-[(4-chloro-3-nitrophenyl)methylsulfanyl]-7H-purine |
|---|---|
| PubChem CID | 62253596 |
| Molecular Formula | C12H8ClN5O2S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 6-[(4-chloro-3-nitrophenyl)methylsulfanyl]-7H-purine |
| SMILES | O=[N+]([O-])c1cc(CSc2ncnc3nc[nH]c23)ccc1Cl |
| InChI | InChI=1S/C12H8ClN5O2S/c13-8-2-1-7(3-9(8)18(19)20)4-21-12-10-11(15-5-14-10)16-6-17-12/h1-3,5-6H,4H2,(H,14,15,16,17) |
| InChIKey | KNNZFXQMMLSOSG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|