C13H10ClN5O3S — CID 86663939
6-chloro-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-7H-purine (PubChem CID 86663939) has the molecular formula C13H10ClN5O3S and a molecular weight of 351.78 g/mol. Its IUPAC name is 6-chloro-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-7H-purine.
| Compound Name | 6-chloro-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-7H-purine |
|---|---|
| PubChem CID | 86663939 |
| Molecular Formula | C13H10ClN5O3S |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 6-chloro-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-7H-purine |
| SMILES | COc1ccc(CSc2nc(Cl)c3[nH]cnc3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10ClN5O3S/c1-22-9-3-2-7(4-8(9)19(20)21)5-23-13-17-11(14)10-12(18-13)16-6-15-10/h2-4,6H,5H2,1H3,(H,15,16,17,18) |
| InChIKey | UIQKPJJYGNQPRL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|