C11H10ClN5O2S — CID 61297511
2-[(4-chloro-3-nitrophenyl)methylsulfanyl]pyrimidine-4,6-diamine (PubChem CID 61297511) has the molecular formula C11H10ClN5O2S and a molecular weight of 311.75 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)methylsulfanyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)methylsulfanyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 61297511 |
| Molecular Formula | C11H10ClN5O2S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)methylsulfanyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCc2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H10ClN5O2S/c12-7-2-1-6(3-8(7)17(18)19)5-20-11-15-9(13)4-10(14)16-11/h1-4H,5H2,(H4,13,14,15,16) |
| InChIKey | ABTJHSIJNKQJRC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|