C14H13ClN2O2S — CID 102924528
2-[(4-chloro-3-nitrophenyl)methylsulfanyl]-4,6-dimethylpyridine (PubChem CID 102924528) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)methylsulfanyl]-4,6-dimethylpyridine.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)methylsulfanyl]-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 102924528 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)methylsulfanyl]-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)nc(SCc2ccc(Cl)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C14H13ClN2O2S/c1-9-5-10(2)16-14(6-9)20-8-11-3-4-12(15)13(7-11)17(18)19/h3-7H,8H2,1-2H3 |
| InChIKey | KVSXOULCOYEMTK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|