C12H8Cl2N2O2S — CID 2960257
2-[(3,4-dichlorophenyl)methylsulfanyl]-5-nitropyridine (PubChem CID 2960257) has the molecular formula C12H8Cl2N2O2S and a molecular weight of 315.18 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanyl]-5-nitropyridine.
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-5-nitropyridine |
|---|---|
| PubChem CID | 2960257 |
| Molecular Formula | C12H8Cl2N2O2S |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-5-nitropyridine |
| SMILES | O=[N+]([O-])c1ccc(SCc2ccc(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C12H8Cl2N2O2S/c13-10-3-1-8(5-11(10)14)7-19-12-4-2-9(6-15-12)16(17)18/h1-6H,7H2 |
| InChIKey | HSPMJJOCQBOCKX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|