C19H15Cl2N2O2+ — CID 78788376
1-[(3,4-dichlorophenyl)methyl]-4-[(4-nitrophenyl)methyl]pyridin-1-ium (PubChem CID 78788376) has the molecular formula C19H15Cl2N2O2+ and a molecular weight of 374.25 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-[(4-nitrophenyl)methyl]pyridin-1-ium.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-[(4-nitrophenyl)methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 78788376 |
| Molecular Formula | C19H15Cl2N2O2+ |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-[(4-nitrophenyl)methyl]pyridin-1-ium |
| SMILES | O=[N+]([O-])c1ccc(Cc2cc[n+](Cc3ccc(Cl)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C19H15Cl2N2O2/c20-18-6-3-16(12-19(18)21)13-22-9-7-15(8-10-22)11-14-1-4-17(5-2-14)23(24)25/h1-10,12H,11,13H2/q+1 |
| InChIKey | FZDXDAKVKHLOFU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|