C19H16N3O4+ — CID 4610547
1,4-bis[(4-nitrophenyl)methyl]pyridin-1-ium (PubChem CID 4610547) has the molecular formula C19H16N3O4+ and a molecular weight of 350.35 g/mol. Its IUPAC name is 1,4-bis[(4-nitrophenyl)methyl]pyridin-1-ium.
| Compound Name | 1,4-bis[(4-nitrophenyl)methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 4610547 |
| Molecular Formula | C19H16N3O4+ |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1,4-bis[(4-nitrophenyl)methyl]pyridin-1-ium |
| SMILES | O=[N+]([O-])c1ccc(Cc2cc[n+](Cc3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C19H16N3O4/c23-21(24)18-5-1-15(2-6-18)13-16-9-11-20(12-10-16)14-17-3-7-19(8-4-17)22(25)26/h1-12H,13-14H2/q+1 |
| InChIKey | QOZSQKZQXLNUKI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|