C22H20N2O4S2 — CID 10365975
1,4-bis[(4-nitrophenyl)methylsulfanylmethyl]benzene (PubChem CID 10365975) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 1,4-bis[(4-nitrophenyl)methylsulfanylmethyl]benzene.
| Compound Name | 1,4-bis[(4-nitrophenyl)methylsulfanylmethyl]benzene |
|---|---|
| PubChem CID | 10365975 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1,4-bis[(4-nitrophenyl)methylsulfanylmethyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(CSCc2ccc(CSCc3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O4S2/c25-23(26)21-9-5-19(6-10-21)15-29-13-17-1-2-18(4-3-17)14-30-16-20-7-11-22(12-8-20)24(27)28/h1-12H,13-16H2 |
| InChIKey | GTAQSQWSHRTTIW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|