C14H16N3O2+ — CID 8865322
N,N-dimethyl-1-[(4-nitrophenyl)methyl]pyridin-1-ium-4-amine (PubChem CID 8865322) has the molecular formula C14H16N3O2+ and a molecular weight of 258.30 g/mol. Its IUPAC name is N,N-dimethyl-1-[(4-nitrophenyl)methyl]pyridin-1-ium-4-amine.
| Compound Name | N,N-dimethyl-1-[(4-nitrophenyl)methyl]pyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 8865322 |
| Molecular Formula | C14H16N3O2+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N,N-dimethyl-1-[(4-nitrophenyl)methyl]pyridin-1-ium-4-amine |
| SMILES | CN(C)c1cc[n+](Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H16N3O2/c1-15(2)13-7-9-16(10-8-13)11-12-3-5-14(6-4-12)17(18)19/h3-10H,11H2,1-2H3/q+1 |
| InChIKey | ZJEDLOYFXBFWPV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|