C21H18BrClN2O4 — CID 78842425
1-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-[(4-nitrophenyl)methyl]pyridin-1-ium chloride (PubChem CID 78842425) has the molecular formula C21H18BrClN2O4 and a molecular weight of 477.74 g/mol. Its IUPAC name is 1-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-[(4-nitrophenyl)methyl]pyridin-1-ium chloride.
| Compound Name | 1-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-[(4-nitrophenyl)methyl]pyridin-1-ium chloride |
|---|---|
| PubChem CID | 78842425 |
| Molecular Formula | C21H18BrClN2O4 |
| Molecular Weight | 477.74 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 1-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-[(4-nitrophenyl)methyl]pyridin-1-ium chloride |
| SMILES | O=[N+]([O-])c1ccc(Cc2cc[n+](Cc3cc4c(cc3Br)OCCO4)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C21H18BrN2O4.ClH/c22-19-13-21-20(27-9-10-28-21)12-17(19)14-23-7-5-16(6-8-23)11-15-1-3-18(4-2-15)24(25)26;/h1-8,12-13H,9-11,14H2;1H/q+1;/p-1 |
| InChIKey | OZLFGDZKWDXDNW-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 65.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.74 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|