About 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine
7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 71905169) has the molecular formula C16H15NO4S
and a molecular weight of 317.37 g/mol. Its IUPAC name is 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine.
Molecular Properties
| Compound Name | 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| PubChem CID | 71905169 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | O=[N+]([O-])c1ccc(CSc2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C16H15NO4S/c18-17(19)13-4-2-12(3-5-13)11-22-14-6-7-15-16(10-14)21-9-1-8-20-15/h2-7,10H,1,8-9,11H2 |
| InChIKey | PMVTWNFXMPTETH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine?
The IUPAC name of 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine (CID 71905169) is 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine.
What is the SMILES notation for 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine?
The canonical SMILES for 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine is O=[N+]([O-])c1ccc(CSc2ccc3c(c2)OCCCO3)cc1.
What is the InChIKey of 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine?
The InChIKey is PMVTWNFXMPTETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4S/c18-17(19)13-4-2-12(3-5-13)11-22-14-6-7-15-16(10-14)21-9-1-8-20-15/h2-7,10H,1,8-9,11H2.
What are the key properties of 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine?
7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine has a molecular weight of 317.37 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine is sourced from PubChem (CID 71905169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).