C16H15NO4S — CID 71905169
7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 71905169) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 71905169 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 7-[(4-nitrophenyl)methylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | O=[N+]([O-])c1ccc(CSc2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C16H15NO4S/c18-17(19)13-4-2-12(3-5-13)11-22-14-6-7-15-16(10-14)21-9-1-8-20-15/h2-7,10H,1,8-9,11H2 |
| InChIKey | PMVTWNFXMPTETH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|