C24H32O5S — CID 58954439
21-benzylsulfanyl-2,5,8,11,17-pentaoxabicyclo[16.4.0]docosa-1(18),19,21-triene (PubChem CID 58954439) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is 21-benzylsulfanyl-2,5,8,11,17-pentaoxabicyclo[16.4.0]docosa-1(18),19,21-triene.
| Compound Name | 21-benzylsulfanyl-2,5,8,11,17-pentaoxabicyclo[16.4.0]docosa-1(18),19,21-triene |
|---|---|
| PubChem CID | 58954439 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 21-benzylsulfanyl-2,5,8,11,17-pentaoxabicyclo[16.4.0]docosa-1(18),19,21-triene |
| SMILES | c1ccc(CSc2ccc3c(c2)OCCOCCOCCOCCCCCO3)cc1 |
| InChI | InChI=1S/C24H32O5S/c1-3-7-21(8-4-1)20-30-22-9-10-23-24(19-22)29-18-17-27-16-15-26-14-13-25-11-5-2-6-12-28-23/h1,3-4,7-10,19H,2,5-6,11-18,20H2 |
| InChIKey | SBAUAJRWVKUKCB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |