C15H15BO4S — CID 115478828
[3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)phenyl]boronic acid (PubChem CID 115478828) has the molecular formula C15H15BO4S and a molecular weight of 302.16 g/mol. Its IUPAC name is [3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)phenyl]boronic acid.
| Compound Name | [3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 115478828 |
| Molecular Formula | C15H15BO4S |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | [3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)phenyl]boronic acid |
| SMILES | OB(O)c1cccc(CSc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C15H15BO4S/c17-16(18)12-3-1-2-11(8-12)10-21-13-4-5-14-15(9-13)20-7-6-19-14/h1-5,8-9,17-18H,6-7,10H2 |
| InChIKey | YJFMBWVHLQGWTK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|