C15H14FNO2S — CID 78985185
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)-4-fluoroaniline (PubChem CID 78985185) has the molecular formula C15H14FNO2S and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)-4-fluoroaniline.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 78985185 |
| Molecular Formula | C15H14FNO2S |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1CSc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H14FNO2S/c16-11-1-3-13(17)10(7-11)9-20-12-2-4-14-15(8-12)19-6-5-18-14/h1-4,7-8H,5-6,9,17H2 |
| InChIKey | JJPRKSSKMZBFRU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|