C14H12ClNO2S — CID 78918860
2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)pyridine (PubChem CID 78918860) has the molecular formula C14H12ClNO2S and a molecular weight of 293.77 g/mol. Its IUPAC name is 2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)pyridine.
| Compound Name | 2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)pyridine |
|---|---|
| PubChem CID | 78918860 |
| Molecular Formula | C14H12ClNO2S |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)pyridine |
| SMILES | Clc1ncccc1CSc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H12ClNO2S/c15-14-10(2-1-5-16-14)9-19-11-3-4-12-13(8-11)18-7-6-17-12/h1-5,8H,6-7,9H2 |
| InChIKey | OSHGQYWAPTTXMN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|