C13H10BrNO2S — CID 113318405
3-bromo-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)pyridine (PubChem CID 113318405) has the molecular formula C13H10BrNO2S and a molecular weight of 324.20 g/mol. Its IUPAC name is 3-bromo-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)pyridine.
| Compound Name | 3-bromo-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)pyridine |
|---|---|
| PubChem CID | 113318405 |
| Molecular Formula | C13H10BrNO2S |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 3-bromo-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)pyridine |
| SMILES | Brc1cccnc1Sc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H10BrNO2S/c14-10-2-1-5-15-13(10)18-9-3-4-11-12(8-9)17-7-6-16-11/h1-5,8H,6-7H2 |
| InChIKey | VXFJTFMRRILLIX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |