C14H12BrNO2S — CID 115478273
3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)aniline (PubChem CID 115478273) has the molecular formula C14H12BrNO2S and a molecular weight of 338.23 g/mol. Its IUPAC name is 3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)aniline.
| Compound Name | 3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 115478273 |
| Molecular Formula | C14H12BrNO2S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)aniline |
| SMILES | Nc1ccc(Sc2ccc3c(c2)OCCO3)c(Br)c1 |
| InChI | InChI=1S/C14H12BrNO2S/c15-11-7-9(16)1-4-14(11)19-10-2-3-12-13(8-10)18-6-5-17-12/h1-4,7-8H,5-6,16H2 |
| InChIKey | KSEZOYNIIVRWDI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|