C16H17NO2S — CID 115479688
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-methylaniline (PubChem CID 115479688) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-methylaniline.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-methylaniline |
|---|---|
| PubChem CID | 115479688 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-methylaniline |
| SMILES | Cc1ccc(Sc2ccc3c(c2)OCCCO3)c(N)c1 |
| InChI | InChI=1S/C16H17NO2S/c1-11-3-6-16(13(17)9-11)20-12-4-5-14-15(10-12)19-8-2-7-18-14/h3-6,9-10H,2,7-8,17H2,1H3 |
| InChIKey | DZTVIYSBIHRWFF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|