C14H11Cl2NO2S — CID 115478328
4,5-dichloro-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)aniline (PubChem CID 115478328) has the molecular formula C14H11Cl2NO2S and a molecular weight of 328.22 g/mol. Its IUPAC name is 4,5-dichloro-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)aniline.
| Compound Name | 4,5-dichloro-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 115478328 |
| Molecular Formula | C14H11Cl2NO2S |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 4,5-dichloro-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)aniline |
| SMILES | Nc1cc(Cl)c(Cl)cc1Sc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H11Cl2NO2S/c15-9-6-11(17)14(7-10(9)16)20-8-1-2-12-13(5-8)19-4-3-18-12/h1-2,5-7H,3-4,17H2 |
| InChIKey | QRERGNCBOQMBQW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|