C15H13NO4S — CID 115478707
5-amino-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)benzoic acid (PubChem CID 115478707) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is 5-amino-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)benzoic acid.
| Compound Name | 5-amino-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 115478707 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-amino-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)benzoic acid |
| SMILES | Nc1ccc(Sc2ccc3c(c2)OCCO3)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H13NO4S/c16-9-1-4-14(11(7-9)15(17)18)21-10-2-3-12-13(8-10)20-6-5-19-12/h1-4,7-8H,5-6,16H2,(H,17,18) |
| InChIKey | JVFSZAJERIAARA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|