C15H14N2O3S — CID 115478319
3-amino-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)benzamide (PubChem CID 115478319) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-amino-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)benzamide.
| Compound Name | 3-amino-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 115478319 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-amino-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)benzamide |
| SMILES | NC(=O)c1ccc(Sc2ccc3c(c2)OCCO3)c(N)c1 |
| InChI | InChI=1S/C15H14N2O3S/c16-11-7-9(15(17)18)1-4-14(11)21-10-2-3-12-13(8-10)20-6-5-19-12/h1-4,7-8H,5-6,16H2,(H2,17,18) |
| InChIKey | XSXFDPKAMUVATC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|