C16H17NO3S — CID 115479704
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-methoxyaniline (PubChem CID 115479704) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-methoxyaniline.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-methoxyaniline |
|---|---|
| PubChem CID | 115479704 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-5-methoxyaniline |
| SMILES | COc1cc(N)cc(Sc2ccc3c(c2)OCCCO3)c1 |
| InChI | InChI=1S/C16H17NO3S/c1-18-12-7-11(17)8-14(9-12)21-13-3-4-15-16(10-13)20-6-2-5-19-15/h3-4,7-10H,2,5-6,17H2,1H3 |
| InChIKey | FNPVYYWLHQJDCS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|