C20H26B2O10 — CID 102194902
(25-borono-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl)boronic acid (PubChem CID 102194902) has the molecular formula C20H26B2O10 and a molecular weight of 448.04 g/mol. Its IUPAC name is (25-borono-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl)boronic acid.
| Compound Name | (25-borono-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl)boronic acid |
|---|---|
| PubChem CID | 102194902 |
| Molecular Formula | C20H26B2O10 |
| Molecular Weight | 448.04 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (25-borono-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl)boronic acid |
| SMILES | OB(O)c1ccc2c(c1)OCCOCCOc1cc(B(O)O)ccc1OCCOCCO2 |
| InChI | InChI=1S/C20H26B2O10/c23-21(24)15-1-3-17-19(13-15)31-11-7-28-8-12-32-20-14-16(22(25)26)2-4-18(20)30-10-6-27-5-9-29-17/h1-4,13-14,23-26H,5-12H2 |
| InChIKey | RFCWDRUVYPOSFU-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.04 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|