C14H20O7S — CID 20583457
2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene-17-sulfinic acid (PubChem CID 20583457) has the molecular formula C14H20O7S and a molecular weight of 332.37 g/mol. Its IUPAC name is 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene-17-sulfinic acid.
| Compound Name | 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene-17-sulfinic acid |
|---|---|
| PubChem CID | 20583457 |
| Molecular Formula | C14H20O7S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene-17-sulfinic acid |
| SMILES | O=S(O)c1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C14H20O7S/c15-22(16)12-1-2-13-14(11-12)21-10-8-19-6-4-17-3-5-18-7-9-20-13/h1-2,11H,3-10H2,(H,15,16) |
| InChIKey | QBOKYVPAQXVUJR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|