C14H19O7S- — CID 20583456
2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene-17-sulfinate (PubChem CID 20583456) has the molecular formula C14H19O7S- and a molecular weight of 331.37 g/mol. Its IUPAC name is 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene-17-sulfinate.
| Compound Name | 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene-17-sulfinate |
|---|---|
| PubChem CID | 20583456 |
| Molecular Formula | C14H19O7S- |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene-17-sulfinate |
| SMILES | O=S([O-])c1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C14H20O7S/c15-22(16)12-1-2-13-14(11-12)21-10-8-19-6-4-17-3-5-18-7-9-20-13/h1-2,11H,3-10H2,(H,15,16)/p-1 |
| InChIKey | QBOKYVPAQXVUJR-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|