C19H23N2O4S- — CID 156797037
3,4-dihydro-2H-1,5-benzodioxepine-7-sulfinate;2-pyrrolidin-1-ylaniline (PubChem CID 156797037) has the molecular formula C19H23N2O4S- and a molecular weight of 375.47 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfinate;2-pyrrolidin-1-ylaniline.
| Compound Name | 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfinate;2-pyrrolidin-1-ylaniline |
|---|---|
| PubChem CID | 156797037 |
| Molecular Formula | C19H23N2O4S- |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfinate;2-pyrrolidin-1-ylaniline |
| SMILES | Nc1ccccc1N1CCCC1.O=S([O-])c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C10H14N2.C9H10O4S/c11-9-5-1-2-6-10(9)12-7-3-4-8-12;10-14(11)7-2-3-8-9(6-7)13-5-1-4-12-8/h1-2,5-6H,3-4,7-8,11H2;2-3,6H,1,4-5H2,(H,10,11)/p-1 |
| InChIKey | SMCKATJIXYCBII-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|