C14H14N2O — CID 82391483
2-(2,3-dihydro-1,4-benzoxazin-4-yl)aniline (PubChem CID 82391483) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzoxazin-4-yl)aniline.
| Compound Name | 2-(2,3-dihydro-1,4-benzoxazin-4-yl)aniline |
|---|---|
| PubChem CID | 82391483 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzoxazin-4-yl)aniline |
| SMILES | Nc1ccccc1N1CCOc2ccccc21 |
| InChI | InChI=1S/C14H14N2O/c15-11-5-1-2-6-12(11)16-9-10-17-14-8-4-3-7-13(14)16/h1-8H,9-10,15H2 |
| InChIKey | ZBKZDLFRQNJBFY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|