C14H12ClNO — CID 117007469
4-(3-chlorophenyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 117007469) has the molecular formula C14H12ClNO and a molecular weight of 245.71 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(3-chlorophenyl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 117007469 |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 4-(3-chlorophenyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | Clc1cccc(N2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C14H12ClNO/c15-11-4-3-5-12(10-11)16-8-9-17-14-7-2-1-6-13(14)16/h1-7,10H,8-9H2 |
| InChIKey | VLBUTIFCOPMCIW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |