C15H14ClNO — CID 117007473
4-(4-chloro-2-methylphenyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 117007473) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenyl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(4-chloro-2-methylphenyl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 117007473 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-(4-chloro-2-methylphenyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | Cc1cc(Cl)ccc1N1CCOc2ccccc21 |
| InChI | InChI=1S/C15H14ClNO/c1-11-10-12(16)6-7-13(11)17-8-9-18-15-5-3-2-4-14(15)17/h2-7,10H,8-9H2,1H3 |
| InChIKey | AAXKXQKAXMBJCY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |