C15H14ClN — CID 954409
2-(4-chloro-2-methylphenyl)-1,3-dihydroisoindole (PubChem CID 954409) has the molecular formula C15H14ClN and a molecular weight of 243.74 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenyl)-1,3-dihydroisoindole.
| Compound Name | 2-(4-chloro-2-methylphenyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 954409 |
| Molecular Formula | C15H14ClN |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-(4-chloro-2-methylphenyl)-1,3-dihydroisoindole |
| SMILES | Cc1cc(Cl)ccc1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H14ClN/c1-11-8-14(16)6-7-15(11)17-9-12-4-2-3-5-13(12)10-17/h2-8H,9-10H2,1H3 |
| InChIKey | MEUIALNKJFWHSS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |