C16H17N — CID 141294642
2-(2-methylphenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 141294642) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(2-methylphenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2-methylphenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 141294642 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-(2-methylphenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1ccccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H17N/c1-13-6-2-5-9-16(13)17-11-10-14-7-3-4-8-15(14)12-17/h2-9H,10-12H2,1H3 |
| InChIKey | YXNRNYROOFEBBI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |