C19H26N2 — CID 145329565
1,3-bis(2-methylphenyl)imidazolidine;ethane (PubChem CID 145329565) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1,3-bis(2-methylphenyl)imidazolidine;ethane.
| Compound Name | 1,3-bis(2-methylphenyl)imidazolidine;ethane |
|---|---|
| PubChem CID | 145329565 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1,3-bis(2-methylphenyl)imidazolidine;ethane |
| SMILES | CC.Cc1ccccc1N1CCN(c2ccccc2C)C1 |
| InChI | InChI=1S/C17H20N2.C2H6/c1-14-7-3-5-9-16(14)18-11-12-19(13-18)17-10-6-4-8-15(17)2;1-2/h3-10H,11-13H2,1-2H3;1-2H3 |
| InChIKey | DLYAAWXYIQRTFX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |