C15H15N — CID 11321753
2-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 11321753) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 11321753 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | c1ccc(N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C15H15N/c1-2-8-15(9-3-1)16-11-10-13-6-4-5-7-14(13)12-16/h1-9H,10-12H2 |
| InChIKey | ONQBUHWENXKHHP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |