C17H20N2 — CID 110454622
4-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-dimethylaniline (PubChem CID 110454622) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 110454622 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-18(2)16-7-9-17(10-8-16)19-12-11-14-5-3-4-6-15(14)13-19/h3-10H,11-13H2,1-2H3 |
| InChIKey | IQUCEEMATSVYSH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|