C15H20N6 — CID 80751354
6-(3,4-dihydro-1H-isoquinolin-2-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80751354) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isoquinolin-2-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80751354 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)C)nc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C15H20N6/c1-16-13-17-14(20(2)3)19-15(18-13)21-9-8-11-6-4-5-7-12(11)10-21/h4-7H,8-10H2,1-3H3,(H,16,17,18,19) |
| InChIKey | ADWBWJMNNHLTBP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |