C14H17FN6 — CID 103504462
6-(6-fluoro-2,3-dihydroindol-1-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 103504462) has the molecular formula C14H17FN6 and a molecular weight of 288.33 g/mol. Its IUPAC name is 6-(6-fluoro-2,3-dihydroindol-1-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-fluoro-2,3-dihydroindol-1-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 103504462 |
| Molecular Formula | C14H17FN6 |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 6-(6-fluoro-2,3-dihydroindol-1-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)C)nc(N2CCc3ccc(F)cc32)n1 |
| InChI | InChI=1S/C14H17FN6/c1-16-12-17-13(20(2)3)19-14(18-12)21-7-6-9-4-5-10(15)8-11(9)21/h4-5,8H,6-7H2,1-3H3,(H,16,17,18,19) |
| InChIKey | BEIAJYKUMNDRJO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |