C14H14FN3O — CID 103493912
6-(6-fluoro-2,3-dihydroindol-1-yl)-2-methoxypyridin-3-amine (PubChem CID 103493912) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is 6-(6-fluoro-2,3-dihydroindol-1-yl)-2-methoxypyridin-3-amine.
| Compound Name | 6-(6-fluoro-2,3-dihydroindol-1-yl)-2-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 103493912 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 6-(6-fluoro-2,3-dihydroindol-1-yl)-2-methoxypyridin-3-amine |
| SMILES | COc1nc(N2CCc3ccc(F)cc32)ccc1N |
| InChI | InChI=1S/C14H14FN3O/c1-19-14-11(16)4-5-13(17-14)18-7-6-9-2-3-10(15)8-12(9)18/h2-5,8H,6-7,16H2,1H3 |
| InChIKey | OEWRGBOZBARFPV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |