C12H22N6O — CID 80764948
6-(2,6-dimethylmorpholin-4-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80764948) has the molecular formula C12H22N6O and a molecular weight of 266.35 g/mol. Its IUPAC name is 6-(2,6-dimethylmorpholin-4-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,6-dimethylmorpholin-4-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80764948 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 6-(2,6-dimethylmorpholin-4-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)C)nc(N2CC(C)OC(C)C2)n1 |
| InChI | InChI=1S/C12H22N6O/c1-8-6-18(7-9(2)19-8)12-15-10(13-3)14-11(16-12)17(4)5/h8-9H,6-7H2,1-5H3,(H,13,14,15,16) |
| InChIKey | VAUKZCIDPUULFU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |