C14H25N7 — CID 80835288
2-N,4-N,4-N-trimethyl-6-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80835288) has the molecular formula C14H25N7 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-N,4-N,4-N-trimethyl-6-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N,4-N-trimethyl-6-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80835288 |
| Molecular Formula | C14H25N7 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-N,4-N,4-N-trimethyl-6-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)C)nc(N2CCC3CCC(C2)N3C)n1 |
| InChI | InChI=1S/C14H25N7/c1-15-12-16-13(19(2)3)18-14(17-12)21-8-7-10-5-6-11(9-21)20(10)4/h10-11H,5-9H2,1-4H3,(H,15,16,17,18) |
| InChIKey | HQOFDSGLCDMZDZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |