C15H13Cl2N — CID 114846605
2-[5-chloro-2-(chloromethyl)phenyl]-1,3-dihydroisoindole (PubChem CID 114846605) has the molecular formula C15H13Cl2N and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-[5-chloro-2-(chloromethyl)phenyl]-1,3-dihydroisoindole.
| Compound Name | 2-[5-chloro-2-(chloromethyl)phenyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 114846605 |
| Molecular Formula | C15H13Cl2N |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[5-chloro-2-(chloromethyl)phenyl]-1,3-dihydroisoindole |
| SMILES | ClCc1ccc(Cl)cc1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H13Cl2N/c16-8-11-5-6-14(17)7-15(11)18-9-12-3-1-2-4-13(12)10-18/h1-7H,8-10H2 |
| InChIKey | PMUQTLAEPDZWGI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|