C16H14ClNO — CID 114843862
4-chloro-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzaldehyde (PubChem CID 114843862) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzaldehyde.
| Compound Name | 4-chloro-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 114843862 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-chloro-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzaldehyde |
| SMILES | O=Cc1ccc(Cl)cc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H14ClNO/c17-15-6-5-14(11-19)16(9-15)18-8-7-12-3-1-2-4-13(12)10-18/h1-6,9,11H,7-8,10H2 |
| InChIKey | CTXGPSWRAGCLBN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|