C14H11F2N — CID 22638395
2-(2,5-difluorophenyl)-1,3-dihydroisoindole (PubChem CID 22638395) has the molecular formula C14H11F2N and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1,3-dihydroisoindole.
| Compound Name | 2-(2,5-difluorophenyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 22638395 |
| Molecular Formula | C14H11F2N |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1,3-dihydroisoindole |
| SMILES | Fc1ccc(F)c(N2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C14H11F2N/c15-12-5-6-13(16)14(7-12)17-8-10-3-1-2-4-11(10)9-17/h1-7H,8-9H2 |
| InChIKey | JIGKPAQCLDQIPC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |