C15H14FNO — CID 62206262
[2-(1,3-dihydroisoindol-2-yl)-5-fluorophenyl]methanol (PubChem CID 62206262) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is [2-(1,3-dihydroisoindol-2-yl)-5-fluorophenyl]methanol.
| Compound Name | [2-(1,3-dihydroisoindol-2-yl)-5-fluorophenyl]methanol |
|---|---|
| PubChem CID | 62206262 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | [2-(1,3-dihydroisoindol-2-yl)-5-fluorophenyl]methanol |
| SMILES | OCc1cc(F)ccc1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H14FNO/c16-14-5-6-15(13(7-14)10-18)17-8-11-3-1-2-4-12(11)9-17/h1-7,18H,8-10H2 |
| InChIKey | GDVRLLZWWMGWBQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |