C11H17NO — CID 142222866
ethane;4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 142222866) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;4-methyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | ethane;4-methyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 142222866 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CC.CN1CCOc2ccccc21 |
| InChI | InChI=1S/C9H11NO.C2H6/c1-10-6-7-11-9-5-3-2-4-8(9)10;1-2/h2-5H,6-7H2,1H3;1-2H3 |
| InChIKey | XPBJKBKRZXNMTL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |