C14H25NO — CID 90795245
4,6-dimethyl-2,3-dihydro-1,4-benzoxazine;ethane (PubChem CID 90795245) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 4,6-dimethyl-2,3-dihydro-1,4-benzoxazine;ethane.
| Compound Name | 4,6-dimethyl-2,3-dihydro-1,4-benzoxazine;ethane |
|---|---|
| PubChem CID | 90795245 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 4,6-dimethyl-2,3-dihydro-1,4-benzoxazine;ethane |
| SMILES | CC.CC.Cc1ccc2c(c1)N(C)CCO2 |
| InChI | InChI=1S/C10H13NO.2C2H6/c1-8-3-4-10-9(7-8)11(2)5-6-12-10;2*1-2/h3-4,7H,5-6H2,1-2H3;2*1-2H3 |
| InChIKey | KVYLPURGDDIXQL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |