C11H16FNO — CID 145415820
ethane;6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 145415820) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is ethane;6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | ethane;6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 145415820 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | ethane;6-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CC.CN1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C9H10FNO.C2H6/c1-11-4-5-12-9-3-2-7(10)6-8(9)11;1-2/h2-3,6H,4-5H2,1H3;1-2H3 |
| InChIKey | FXPRDOYYVWIXQN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |