C11H12FNO2 — CID 110639273
1-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-one (PubChem CID 110639273) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 1-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-one.
| Compound Name | 1-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 110639273 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-one |
| SMILES | CCC(=O)N1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C11H12FNO2/c1-2-11(14)13-5-6-15-10-4-3-8(12)7-9(10)13/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | ICFTYYXGRYKELP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |